C24H28N6O2S — CID 53038876
N-(2,4-dimethylphenyl)-2-[[11-(4-methoxyphenyl)-3,4,6,9,10-pentazatricyclo[7.3.0.02,6]dodeca-4,7-dien-5-yl]sulfanyl]acetamide (PubChem CID 53038876) has the molecular formula C24H28N6O2S and a molecular weight of 464.60 g/mol. Its IUPAC name is N-(2,4-dimethylphenyl)-2-[[11-(4-methoxyphenyl)-3,4,6,9,10-pentazatricyclo[7.3.0.02,6]dodeca-4,7-dien-5-yl]sulfanyl]acetamide.
| Compound Name | N-(2,4-dimethylphenyl)-2-[[11-(4-methoxyphenyl)-3,4,6,9,10-pentazatricyclo[7.3.0.02,6]dodeca-4,7-dien-5-yl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 53038876 |
| Molecular Formula | C24H28N6O2S |
| Molecular Weight | 464.60 g/mol |
| Exact Mass | 464.20 |
| IUPAC Name | N-(2,4-dimethylphenyl)-2-[[11-(4-methoxyphenyl)-3,4,6,9,10-pentazatricyclo[7.3.0.02,6]dodeca-4,7-dien-5-yl]sulfanyl]acetamide |
| SMILES | COc1ccc(C2CC3C4NN=C(SCC(=O)Nc5ccc(C)cc5C)N4C=CN3N2)cc1 |
| InChI | InChI=1S/C24H28N6O2S/c1-15-4-9-19(16(2)12-15)25-22(31)14-33-24-27-26-23-21-13-20(28-30(21)11-10-29(23)24)17-5-7-18(32-3)8-6-17/h4-12,20-21,23,26,28H,13-14H2,1-3H3,(H,25,31) |
| InChIKey | BKYRZEOQTUIYOT-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 81.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.60 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |