C24H27ClN6OS — CID 53038831
N-[(2-chlorophenyl)methyl]-2-[[11-(2,5-dimethylphenyl)-3,4,6,9,10-pentazatricyclo[7.3.0.02,6]dodeca-4,7-dien-5-yl]sulfanyl]acetamide (PubChem CID 53038831) has the molecular formula C24H27ClN6OS and a molecular weight of 483.04 g/mol. Its IUPAC name is N-[(2-chlorophenyl)methyl]-2-[[11-(2,5-dimethylphenyl)-3,4,6,9,10-pentazatricyclo[7.3.0.02,6]dodeca-4,7-dien-5-yl]sulfanyl]acetamide.
| Compound Name | N-[(2-chlorophenyl)methyl]-2-[[11-(2,5-dimethylphenyl)-3,4,6,9,10-pentazatricyclo[7.3.0.02,6]dodeca-4,7-dien-5-yl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 53038831 |
| Molecular Formula | C24H27ClN6OS |
| Molecular Weight | 483.04 g/mol |
| Exact Mass | 482.17 |
| IUPAC Name | N-[(2-chlorophenyl)methyl]-2-[[11-(2,5-dimethylphenyl)-3,4,6,9,10-pentazatricyclo[7.3.0.02,6]dodeca-4,7-dien-5-yl]sulfanyl]acetamide |
| SMILES | Cc1ccc(C)c(C2CC3C4NN=C(SCC(=O)NCc5ccccc5Cl)N4C=CN3N2)c1 |
| InChI | InChI=1S/C24H27ClN6OS/c1-15-7-8-16(2)18(11-15)20-12-21-23-27-28-24(30(23)9-10-31(21)29-20)33-14-22(32)26-13-17-5-3-4-6-19(17)25/h3-11,20-21,23,27,29H,12-14H2,1-2H3,(H,26,32) |
| InChIKey | OFUPZXKJOJNHSS-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 72.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.04 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |