C20H25FN6OS — CID 51893923
2-[[11-(4-fluorophenyl)-3,4,6,9,10-pentazatricyclo[7.3.0.02,6]dodeca-4,7-dien-5-yl]sulfanyl]-1-piperidin-1-ylethanone (PubChem CID 51893923) has the molecular formula C20H25FN6OS and a molecular weight of 416.53 g/mol. Its IUPAC name is 2-[[11-(4-fluorophenyl)-3,4,6,9,10-pentazatricyclo[7.3.0.02,6]dodeca-4,7-dien-5-yl]sulfanyl]-1-piperidin-1-ylethanone.
| Compound Name | 2-[[11-(4-fluorophenyl)-3,4,6,9,10-pentazatricyclo[7.3.0.02,6]dodeca-4,7-dien-5-yl]sulfanyl]-1-piperidin-1-ylethanone |
|---|---|
| PubChem CID | 51893923 |
| Molecular Formula | C20H25FN6OS |
| Molecular Weight | 416.53 g/mol |
| Exact Mass | 416.18 |
| IUPAC Name | 2-[[11-(4-fluorophenyl)-3,4,6,9,10-pentazatricyclo[7.3.0.02,6]dodeca-4,7-dien-5-yl]sulfanyl]-1-piperidin-1-ylethanone |
| SMILES | O=C(CSC1=NNC2C3CC(c4ccc(F)cc4)NN3C=CN12)N1CCCCC1 |
| InChI | InChI=1S/C20H25FN6OS/c21-15-6-4-14(5-7-15)16-12-17-19-22-23-20(26(19)10-11-27(17)24-16)29-13-18(28)25-8-2-1-3-9-25/h4-7,10-11,16-17,19,22,24H,1-3,8-9,12-13H2 |
| InChIKey | ADXIYRDRENDIBL-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 63.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.53 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |