C22H24N6O2S — CID 53006837
N-(3-methoxyphenyl)-2-[(11-phenyl-3,4,6,9,10-pentazatricyclo[7.3.0.02,6]dodeca-4,7-dien-5-yl)sulfanyl]acetamide (PubChem CID 53006837) has the molecular formula C22H24N6O2S and a molecular weight of 436.54 g/mol. Its IUPAC name is N-(3-methoxyphenyl)-2-[(11-phenyl-3,4,6,9,10-pentazatricyclo[7.3.0.02,6]dodeca-4,7-dien-5-yl)sulfanyl]acetamide.
| Compound Name | N-(3-methoxyphenyl)-2-[(11-phenyl-3,4,6,9,10-pentazatricyclo[7.3.0.02,6]dodeca-4,7-dien-5-yl)sulfanyl]acetamide |
|---|---|
| PubChem CID | 53006837 |
| Molecular Formula | C22H24N6O2S |
| Molecular Weight | 436.54 g/mol |
| Exact Mass | 436.17 |
| IUPAC Name | N-(3-methoxyphenyl)-2-[(11-phenyl-3,4,6,9,10-pentazatricyclo[7.3.0.02,6]dodeca-4,7-dien-5-yl)sulfanyl]acetamide |
| SMILES | COc1cccc(NC(=O)CSC2=NNC3C4CC(c5ccccc5)NN4C=CN23)c1 |
| InChI | InChI=1S/C22H24N6O2S/c1-30-17-9-5-8-16(12-17)23-20(29)14-31-22-25-24-21-19-13-18(15-6-3-2-4-7-15)26-28(19)11-10-27(21)22/h2-12,18-19,21,24,26H,13-14H2,1H3,(H,23,29) |
| InChIKey | JJINUQJLXHIEMT-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 81.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.54 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |