C18H17N3O5S — CID 51928841
[(1S)-1-[5-(4-methylphenyl)-1,3,4-oxadiazol-2-yl]ethyl] 3-sulfamoylbenzoate (PubChem CID 51928841) has the molecular formula C18H17N3O5S and a molecular weight of 387.42 g/mol. Its IUPAC name is [(1S)-1-[5-(4-methylphenyl)-1,3,4-oxadiazol-2-yl]ethyl] 3-sulfamoylbenzoate.
| Compound Name | [(1S)-1-[5-(4-methylphenyl)-1,3,4-oxadiazol-2-yl]ethyl] 3-sulfamoylbenzoate |
|---|---|
| PubChem CID | 51928841 |
| Molecular Formula | C18H17N3O5S |
| Molecular Weight | 387.42 g/mol |
| Exact Mass | 387.09 |
| IUPAC Name | [(1S)-1-[5-(4-methylphenyl)-1,3,4-oxadiazol-2-yl]ethyl] 3-sulfamoylbenzoate |
| SMILES | Cc1ccc(-c2nnc([C@H](C)OC(=O)c3cccc(S(N)(=O)=O)c3)o2)cc1 |
| InChI | InChI=1S/C18H17N3O5S/c1-11-6-8-13(9-7-11)17-21-20-16(26-17)12(2)25-18(22)14-4-3-5-15(10-14)27(19,23)24/h3-10,12H,1-2H3,(H2,19,23,24)/t12-/m0/s1 |
| InChIKey | PVMCEMKEPOLUIN-LBPRGKRZSA-N |
| XLogP | 2.61 |
| TPSA | 125.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.42 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |