C18H17N3O5S — CID 55386289
1-(5-phenyl-1,3,4-oxadiazol-2-yl)ethyl 2-methyl-5-sulfamoylbenzoate (PubChem CID 55386289) has the molecular formula C18H17N3O5S and a molecular weight of 387.42 g/mol. Its IUPAC name is 1-(5-phenyl-1,3,4-oxadiazol-2-yl)ethyl 2-methyl-5-sulfamoylbenzoate.
| Compound Name | 1-(5-phenyl-1,3,4-oxadiazol-2-yl)ethyl 2-methyl-5-sulfamoylbenzoate |
|---|---|
| PubChem CID | 55386289 |
| Molecular Formula | C18H17N3O5S |
| Molecular Weight | 387.42 g/mol |
| Exact Mass | 387.09 |
| IUPAC Name | 1-(5-phenyl-1,3,4-oxadiazol-2-yl)ethyl 2-methyl-5-sulfamoylbenzoate |
| SMILES | Cc1ccc(S(N)(=O)=O)cc1C(=O)OC(C)c1nnc(-c2ccccc2)o1 |
| InChI | InChI=1S/C18H17N3O5S/c1-11-8-9-14(27(19,23)24)10-15(11)18(22)25-12(2)16-20-21-17(26-16)13-6-4-3-5-7-13/h3-10,12H,1-2H3,(H2,19,23,24) |
| InChIKey | FJKZLCDQGOIABJ-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 125.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.42 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |