C18H17N3O6S — CID 47008849
1-(5-phenyl-1,3,4-oxadiazol-2-yl)ethyl 2-methoxy-5-sulfamoylbenzoate (PubChem CID 47008849) has the molecular formula C18H17N3O6S and a molecular weight of 403.42 g/mol. Its IUPAC name is 1-(5-phenyl-1,3,4-oxadiazol-2-yl)ethyl 2-methoxy-5-sulfamoylbenzoate.
| Compound Name | 1-(5-phenyl-1,3,4-oxadiazol-2-yl)ethyl 2-methoxy-5-sulfamoylbenzoate |
|---|---|
| PubChem CID | 47008849 |
| Molecular Formula | C18H17N3O6S |
| Molecular Weight | 403.42 g/mol |
| Exact Mass | 403.08 |
| IUPAC Name | 1-(5-phenyl-1,3,4-oxadiazol-2-yl)ethyl 2-methoxy-5-sulfamoylbenzoate |
| SMILES | COc1ccc(S(N)(=O)=O)cc1C(=O)OC(C)c1nnc(-c2ccccc2)o1 |
| InChI | InChI=1S/C18H17N3O6S/c1-11(16-20-21-17(27-16)12-6-4-3-5-7-12)26-18(22)14-10-13(28(19,23)24)8-9-15(14)25-2/h3-11H,1-2H3,(H2,19,23,24) |
| InChIKey | AOUVHCIUXMCKRK-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 134.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.42 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |