C24H25NO4 — CID 51930984
[(2S)-2,3-dihydro-1-benzofuran-2-yl]-spiro[2,3,6,8-tetrahydro-[1,4]dioxino[2,3-g]isoquinoline-9,1'-cyclopentane]-7-ylmethanone (PubChem CID 51930984) has the molecular formula C24H25NO4 and a molecular weight of 391.47 g/mol. Its IUPAC name is [(2S)-2,3-dihydro-1-benzofuran-2-yl]-spiro[2,3,6,8-tetrahydro-[1,4]dioxino[2,3-g]isoquinoline-9,1'-cyclopentane]-7-ylmethanone.
| Compound Name | [(2S)-2,3-dihydro-1-benzofuran-2-yl]-spiro[2,3,6,8-tetrahydro-[1,4]dioxino[2,3-g]isoquinoline-9,1'-cyclopentane]-7-ylmethanone |
|---|---|
| PubChem CID | 51930984 |
| Molecular Formula | C24H25NO4 |
| Molecular Weight | 391.47 g/mol |
| Exact Mass | 391.18 |
| IUPAC Name | [(2S)-2,3-dihydro-1-benzofuran-2-yl]-spiro[2,3,6,8-tetrahydro-[1,4]dioxino[2,3-g]isoquinoline-9,1'-cyclopentane]-7-ylmethanone |
| SMILES | O=C([C@@H]1Cc2ccccc2O1)N1Cc2cc3c(cc2C2(CCCC2)C1)OCCO3 |
| InChI | InChI=1S/C24H25NO4/c26-23(22-11-16-5-1-2-6-19(16)29-22)25-14-17-12-20-21(28-10-9-27-20)13-18(17)24(15-25)7-3-4-8-24/h1-2,5-6,12-13,22H,3-4,7-11,14-15H2/t22-/m0/s1 |
| InChIKey | LJJBBFXHNIRJLF-QFIPXVFZSA-N |
| XLogP | 3.62 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.47 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |