C26H25ClN2O5 — CID 5193229
N-[2-[1,3-benzodioxol-5-ylmethyl(furan-2-ylmethyl)amino]-2-oxoethyl]-2-chloro-2-phenyl-N-prop-2-enylacetamide (PubChem CID 5193229) has the molecular formula C26H25ClN2O5 and a molecular weight of 480.95 g/mol. Its IUPAC name is N-[2-[1,3-benzodioxol-5-ylmethyl(furan-2-ylmethyl)amino]-2-oxoethyl]-2-chloro-2-phenyl-N-prop-2-enylacetamide.
| Compound Name | N-[2-[1,3-benzodioxol-5-ylmethyl(furan-2-ylmethyl)amino]-2-oxoethyl]-2-chloro-2-phenyl-N-prop-2-enylacetamide |
|---|---|
| PubChem CID | 5193229 |
| Molecular Formula | C26H25ClN2O5 |
| Molecular Weight | 480.95 g/mol |
| Exact Mass | 480.15 |
| IUPAC Name | N-[2-[1,3-benzodioxol-5-ylmethyl(furan-2-ylmethyl)amino]-2-oxoethyl]-2-chloro-2-phenyl-N-prop-2-enylacetamide |
| SMILES | C=CCN(CC(=O)N(Cc1ccc2c(c1)OCO2)Cc1ccco1)C(=O)C(Cl)c1ccccc1 |
| InChI | InChI=1S/C26H25ClN2O5/c1-2-12-28(26(31)25(27)20-7-4-3-5-8-20)17-24(30)29(16-21-9-6-13-32-21)15-19-10-11-22-23(14-19)34-18-33-22/h2-11,13-14,25H,1,12,15-18H2 |
| InChIKey | BZFUXTXDNAWACV-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 72.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.95 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|