C25H22ClN3O7 — CID 42664628
N-[2-[1,3-benzodioxol-5-ylmethyl(furan-2-ylmethyl)amino]-2-oxoethyl]-2-chloro-4-nitro-N-prop-2-enylbenzamide (PubChem CID 42664628) has the molecular formula C25H22ClN3O7 and a molecular weight of 511.92 g/mol. Its IUPAC name is N-[2-[1,3-benzodioxol-5-ylmethyl(furan-2-ylmethyl)amino]-2-oxoethyl]-2-chloro-4-nitro-N-prop-2-enylbenzamide.
| Compound Name | N-[2-[1,3-benzodioxol-5-ylmethyl(furan-2-ylmethyl)amino]-2-oxoethyl]-2-chloro-4-nitro-N-prop-2-enylbenzamide |
|---|---|
| PubChem CID | 42664628 |
| Molecular Formula | C25H22ClN3O7 |
| Molecular Weight | 511.92 g/mol |
| Exact Mass | 511.11 |
| IUPAC Name | N-[2-[1,3-benzodioxol-5-ylmethyl(furan-2-ylmethyl)amino]-2-oxoethyl]-2-chloro-4-nitro-N-prop-2-enylbenzamide |
| SMILES | C=CCN(CC(=O)N(Cc1ccc2c(c1)OCO2)Cc1ccco1)C(=O)c1ccc([N+](=O)[O-])cc1Cl |
| InChI | InChI=1S/C25H22ClN3O7/c1-2-9-27(25(31)20-7-6-18(29(32)33)12-21(20)26)15-24(30)28(14-19-4-3-10-34-19)13-17-5-8-22-23(11-17)36-16-35-22/h2-8,10-12H,1,9,13-16H2 |
| InChIKey | WHGXSLMSEWCVTH-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 115.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.92 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|