C23H21N3O5 — CID 51932454
[(1S)-1-(3-tert-butyl-1,2,4-oxadiazol-5-yl)ethyl] 4-(1,3-dioxoisoindol-2-yl)benzoate (PubChem CID 51932454) has the molecular formula C23H21N3O5 and a molecular weight of 419.44 g/mol. Its IUPAC name is [(1S)-1-(3-tert-butyl-1,2,4-oxadiazol-5-yl)ethyl] 4-(1,3-dioxoisoindol-2-yl)benzoate.
| Compound Name | [(1S)-1-(3-tert-butyl-1,2,4-oxadiazol-5-yl)ethyl] 4-(1,3-dioxoisoindol-2-yl)benzoate |
|---|---|
| PubChem CID | 51932454 |
| Molecular Formula | C23H21N3O5 |
| Molecular Weight | 419.44 g/mol |
| Exact Mass | 419.15 |
| IUPAC Name | [(1S)-1-(3-tert-butyl-1,2,4-oxadiazol-5-yl)ethyl] 4-(1,3-dioxoisoindol-2-yl)benzoate |
| SMILES | C[C@H](OC(=O)c1ccc(N2C(=O)c3ccccc3C2=O)cc1)c1nc(C(C)(C)C)no1 |
| InChI | InChI=1S/C23H21N3O5/c1-13(18-24-22(25-31-18)23(2,3)4)30-21(29)14-9-11-15(12-10-14)26-19(27)16-7-5-6-8-17(16)20(26)28/h5-13H,1-4H3/t13-/m0/s1 |
| InChIKey | AFFXYQHVVIFFJZ-ZDUSSCGKSA-N |
| XLogP | 4.09 |
| TPSA | 102.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.44 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|