C18H22N2O4 — CID 55569608
1-(3-tert-butyl-1,2,4-oxadiazol-5-yl)ethyl 4-prop-2-enoxybenzoate (PubChem CID 55569608) has the molecular formula C18H22N2O4 and a molecular weight of 330.38 g/mol. Its IUPAC name is 1-(3-tert-butyl-1,2,4-oxadiazol-5-yl)ethyl 4-prop-2-enoxybenzoate.
| Compound Name | 1-(3-tert-butyl-1,2,4-oxadiazol-5-yl)ethyl 4-prop-2-enoxybenzoate |
|---|---|
| PubChem CID | 55569608 |
| Molecular Formula | C18H22N2O4 |
| Molecular Weight | 330.38 g/mol |
| Exact Mass | 330.16 |
| IUPAC Name | 1-(3-tert-butyl-1,2,4-oxadiazol-5-yl)ethyl 4-prop-2-enoxybenzoate |
| SMILES | C=CCOc1ccc(C(=O)OC(C)c2nc(C(C)(C)C)no2)cc1 |
| InChI | InChI=1S/C18H22N2O4/c1-6-11-22-14-9-7-13(8-10-14)16(21)23-12(2)15-19-17(20-24-15)18(3,4)5/h6-10,12H,1,11H2,2-5H3 |
| InChIKey | CLPJZLHPGXOWKY-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 74.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.38 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|