C15H18Cl2N2O3 — CID 51933134
(5S)-5-(3,4-dichlorophenyl)-5-methyl-3-(2-propan-2-yloxyethyl)imidazolidine-2,4-dione (PubChem CID 51933134) has the molecular formula C15H18Cl2N2O3 and a molecular weight of 345.23 g/mol. Its IUPAC name is (5S)-5-(3,4-dichlorophenyl)-5-methyl-3-(2-propan-2-yloxyethyl)imidazolidine-2,4-dione.
| Compound Name | (5S)-5-(3,4-dichlorophenyl)-5-methyl-3-(2-propan-2-yloxyethyl)imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 51933134 |
| Molecular Formula | C15H18Cl2N2O3 |
| Molecular Weight | 345.23 g/mol |
| Exact Mass | 344.07 |
| IUPAC Name | (5S)-5-(3,4-dichlorophenyl)-5-methyl-3-(2-propan-2-yloxyethyl)imidazolidine-2,4-dione |
| SMILES | CC(C)OCCN1C(=O)N[C@@](C)(c2ccc(Cl)c(Cl)c2)C1=O |
| InChI | InChI=1S/C15H18Cl2N2O3/c1-9(2)22-7-6-19-13(20)15(3,18-14(19)21)10-4-5-11(16)12(17)8-10/h4-5,8-9H,6-7H2,1-3H3,(H,18,21)/t15-/m0/s1 |
| InChIKey | YMFLCDRIBOTLEQ-HNNXBMFYSA-N |
| XLogP | 3.19 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.23 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|