C15H20ClN3O3 — CID 82148435
3-[2-(2-aminoethoxy)ethyl]-5-(4-chloro-3-methylphenyl)-5-methylimidazolidine-2,4-dione (PubChem CID 82148435) has the molecular formula C15H20ClN3O3 and a molecular weight of 325.80 g/mol. Its IUPAC name is 3-[2-(2-aminoethoxy)ethyl]-5-(4-chloro-3-methylphenyl)-5-methylimidazolidine-2,4-dione.
| Compound Name | 3-[2-(2-aminoethoxy)ethyl]-5-(4-chloro-3-methylphenyl)-5-methylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 82148435 |
| Molecular Formula | C15H20ClN3O3 |
| Molecular Weight | 325.80 g/mol |
| Exact Mass | 325.12 |
| IUPAC Name | 3-[2-(2-aminoethoxy)ethyl]-5-(4-chloro-3-methylphenyl)-5-methylimidazolidine-2,4-dione |
| SMILES | Cc1cc(C2(C)NC(=O)N(CCOCCN)C2=O)ccc1Cl |
| InChI | InChI=1S/C15H20ClN3O3/c1-10-9-11(3-4-12(10)16)15(2)13(20)19(14(21)18-15)6-8-22-7-5-17/h3-4,9H,5-8,17H2,1-2H3,(H,18,21) |
| InChIKey | ISEHRYWBTZBXHX-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.80 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|