C20H24FN3O2S — CID 51935494
(3S)-3-(carbamoylamino)-N-[2-(3,4-dimethylphenyl)sulfanylethyl]-3-(2-fluorophenyl)propanamide (PubChem CID 51935494) has the molecular formula C20H24FN3O2S and a molecular weight of 389.50 g/mol. Its IUPAC name is (3S)-3-(carbamoylamino)-N-[2-(3,4-dimethylphenyl)sulfanylethyl]-3-(2-fluorophenyl)propanamide.
| Compound Name | (3S)-3-(carbamoylamino)-N-[2-(3,4-dimethylphenyl)sulfanylethyl]-3-(2-fluorophenyl)propanamide |
|---|---|
| PubChem CID | 51935494 |
| Molecular Formula | C20H24FN3O2S |
| Molecular Weight | 389.50 g/mol |
| Exact Mass | 389.16 |
| IUPAC Name | (3S)-3-(carbamoylamino)-N-[2-(3,4-dimethylphenyl)sulfanylethyl]-3-(2-fluorophenyl)propanamide |
| SMILES | Cc1ccc(SCCNC(=O)C[C@H](NC(N)=O)c2ccccc2F)cc1C |
| InChI | InChI=1S/C20H24FN3O2S/c1-13-7-8-15(11-14(13)2)27-10-9-23-19(25)12-18(24-20(22)26)16-5-3-4-6-17(16)21/h3-8,11,18H,9-10,12H2,1-2H3,(H,23,25)(H3,22,24,26)/t18-/m0/s1 |
| InChIKey | RHCDOXILKGAPFO-SFHVURJKSA-N |
| XLogP | 3.45 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.50 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|