C19H30FN3O2 — CID 98367833
(3R)-3-(carbamoylamino)-3-(2-fluorophenyl)-N-nonylpropanamide (PubChem CID 98367833) has the molecular formula C19H30FN3O2 and a molecular weight of 351.47 g/mol. Its IUPAC name is (3R)-3-(carbamoylamino)-3-(2-fluorophenyl)-N-nonylpropanamide.
| Compound Name | (3R)-3-(carbamoylamino)-3-(2-fluorophenyl)-N-nonylpropanamide |
|---|---|
| PubChem CID | 98367833 |
| Molecular Formula | C19H30FN3O2 |
| Molecular Weight | 351.47 g/mol |
| Exact Mass | 351.23 |
| IUPAC Name | (3R)-3-(carbamoylamino)-3-(2-fluorophenyl)-N-nonylpropanamide |
| SMILES | CCCCCCCCCNC(=O)C[C@@H](NC(N)=O)c1ccccc1F |
| InChI | InChI=1S/C19H30FN3O2/c1-2-3-4-5-6-7-10-13-22-18(24)14-17(23-19(21)25)15-11-8-9-12-16(15)20/h8-9,11-12,17H,2-7,10,13-14H2,1H3,(H,22,24)(H3,21,23,25)/t17-/m1/s1 |
| InChIKey | VCGPFSVJXFIHSU-QGZVFWFLSA-N |
| XLogP | 3.79 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.47 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|