C28H30FN5O2 — CID 42953327
3-(carbamoylamino)-N-[2-[4-(dimethylamino)phenyl]-2-(1H-indol-3-yl)ethyl]-3-(2-fluorophenyl)propanamide (PubChem CID 42953327) has the molecular formula C28H30FN5O2 and a molecular weight of 487.58 g/mol. Its IUPAC name is 3-(carbamoylamino)-N-[2-[4-(dimethylamino)phenyl]-2-(1H-indol-3-yl)ethyl]-3-(2-fluorophenyl)propanamide.
| Compound Name | 3-(carbamoylamino)-N-[2-[4-(dimethylamino)phenyl]-2-(1H-indol-3-yl)ethyl]-3-(2-fluorophenyl)propanamide |
|---|---|
| PubChem CID | 42953327 |
| Molecular Formula | C28H30FN5O2 |
| Molecular Weight | 487.58 g/mol |
| Exact Mass | 487.24 |
| IUPAC Name | 3-(carbamoylamino)-N-[2-[4-(dimethylamino)phenyl]-2-(1H-indol-3-yl)ethyl]-3-(2-fluorophenyl)propanamide |
| SMILES | CN(C)c1ccc(C(CNC(=O)CC(NC(N)=O)c2ccccc2F)c2c[nH]c3ccccc23)cc1 |
| InChI | InChI=1S/C28H30FN5O2/c1-34(2)19-13-11-18(12-14-19)22(23-17-31-25-10-6-4-7-20(23)25)16-32-27(35)15-26(33-28(30)36)21-8-3-5-9-24(21)29/h3-14,17,22,26,31H,15-16H2,1-2H3,(H,32,35)(H3,30,33,36) |
| InChIKey | AHRJSNSUUIZVIY-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 103.25 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.58 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|