C19H23FN4O2 — CID 39641678
[(1R)-3-[2-ethyl-2-(4-methylphenyl)hydrazinyl]-1-(2-fluorophenyl)-3-oxopropyl]urea (PubChem CID 39641678) has the molecular formula C19H23FN4O2 and a molecular weight of 358.42 g/mol. Its IUPAC name is [(1R)-3-[2-ethyl-2-(4-methylphenyl)hydrazinyl]-1-(2-fluorophenyl)-3-oxopropyl]urea.
| Compound Name | [(1R)-3-[2-ethyl-2-(4-methylphenyl)hydrazinyl]-1-(2-fluorophenyl)-3-oxopropyl]urea |
|---|---|
| PubChem CID | 39641678 |
| Molecular Formula | C19H23FN4O2 |
| Molecular Weight | 358.42 g/mol |
| Exact Mass | 358.18 |
| IUPAC Name | [(1R)-3-[2-ethyl-2-(4-methylphenyl)hydrazinyl]-1-(2-fluorophenyl)-3-oxopropyl]urea |
| SMILES | CCN(NC(=O)C[C@@H](NC(N)=O)c1ccccc1F)c1ccc(C)cc1 |
| InChI | InChI=1S/C19H23FN4O2/c1-3-24(14-10-8-13(2)9-11-14)23-18(25)12-17(22-19(21)26)15-6-4-5-7-16(15)20/h4-11,17H,3,12H2,1-2H3,(H,23,25)(H3,21,22,26)/t17-/m1/s1 |
| InChIKey | FSMATDMBRPLTMP-QGZVFWFLSA-N |
| XLogP | 2.79 |
| TPSA | 87.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.42 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|