About N-[(1R)-1-(2,5-difluorophenyl)ethyl]-4-ethylthiadiazole-5-carboxamide
N-[(1R)-1-(2,5-difluorophenyl)ethyl]-4-ethylthiadiazole-5-carboxamide (PubChem CID 51935776) has the molecular formula C13H13F2N3OS
and a molecular weight of 297.33 g/mol. Its IUPAC name is N-[(1R)-1-(2,5-difluorophenyl)ethyl]-4-ethylthiadiazole-5-carboxamide.
Molecular Properties
| Compound Name | N-[(1R)-1-(2,5-difluorophenyl)ethyl]-4-ethylthiadiazole-5-carboxamide |
| PubChem CID | 51935776 |
| Molecular Formula | C13H13F2N3OS |
| Molecular Weight | 297.33 g/mol |
| Exact Mass | 297.07 |
| IUPAC Name | N-[(1R)-1-(2,5-difluorophenyl)ethyl]-4-ethylthiadiazole-5-carboxamide |
| SMILES | CCc1nnsc1C(=O)N[C@H](C)c1cc(F)ccc1F |
| InChI | InChI=1S/C13H13F2N3OS/c1-3-11-12(20-18-17-11)13(19)16-7(2)9-6-8(14)4-5-10(9)15/h4-7H,3H2,1-2H3,(H,16,19)/t7-/m1/s1 |
| InChIKey | QYCSKBQVRIHQLF-SSDOTTSWSA-N |
| XLogP | 2.87 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 297.33 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-[(1R)-1-(2,5-difluorophenyl)ethyl]-4-ethylthiadiazole-5-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(1R)-1-(2,5-difluorophenyl)ethyl]-4-ethylthiadiazole-5-carboxamide?
The IUPAC name of N-[(1R)-1-(2,5-difluorophenyl)ethyl]-4-ethylthiadiazole-5-carboxamide (CID 51935776) is N-[(1R)-1-(2,5-difluorophenyl)ethyl]-4-ethylthiadiazole-5-carboxamide.
What is the SMILES notation for N-[(1R)-1-(2,5-difluorophenyl)ethyl]-4-ethylthiadiazole-5-carboxamide?
The canonical SMILES for N-[(1R)-1-(2,5-difluorophenyl)ethyl]-4-ethylthiadiazole-5-carboxamide is CCc1nnsc1C(=O)N[C@H](C)c1cc(F)ccc1F.
What is the InChIKey of N-[(1R)-1-(2,5-difluorophenyl)ethyl]-4-ethylthiadiazole-5-carboxamide?
The InChIKey is QYCSKBQVRIHQLF-SSDOTTSWSA-N. The full InChI is InChI=1S/C13H13F2N3OS/c1-3-11-12(20-18-17-11)13(19)16-7(2)9-6-8(14)4-5-10(9)15/h4-7H,3H2,1-2H3,(H,16,19)/t7-/m1/s1.
What are the key properties of N-[(1R)-1-(2,5-difluorophenyl)ethyl]-4-ethylthiadiazole-5-carboxamide?
N-[(1R)-1-(2,5-difluorophenyl)ethyl]-4-ethylthiadiazole-5-carboxamide has a molecular weight of 297.33 g/mol, XLogP of 2.87, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(1R)-1-(2,5-difluorophenyl)ethyl]-4-ethylthiadiazole-5-carboxamide is sourced from PubChem (CID 51935776), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).