C21H22N2O3 — CID 51935797
(2S,4R)-1-[(E)-3-(3-methoxyphenyl)prop-2-enoyl]-2-methyl-3,4-dihydro-2H-quinoline-4-carboxamide (PubChem CID 51935797) has the molecular formula C21H22N2O3 and a molecular weight of 350.42 g/mol. Its IUPAC name is (2S,4R)-1-[(E)-3-(3-methoxyphenyl)prop-2-enoyl]-2-methyl-3,4-dihydro-2H-quinoline-4-carboxamide.
| Compound Name | (2S,4R)-1-[(E)-3-(3-methoxyphenyl)prop-2-enoyl]-2-methyl-3,4-dihydro-2H-quinoline-4-carboxamide |
|---|---|
| PubChem CID | 51935797 |
| Molecular Formula | C21H22N2O3 |
| Molecular Weight | 350.42 g/mol |
| Exact Mass | 350.16 |
| IUPAC Name | (2S,4R)-1-[(E)-3-(3-methoxyphenyl)prop-2-enoyl]-2-methyl-3,4-dihydro-2H-quinoline-4-carboxamide |
| SMILES | COc1cccc(/C=C/C(=O)N2c3ccccc3[C@H](C(N)=O)C[C@@H]2C)c1 |
| InChI | InChI=1S/C21H22N2O3/c1-14-12-18(21(22)25)17-8-3-4-9-19(17)23(14)20(24)11-10-15-6-5-7-16(13-15)26-2/h3-11,13-14,18H,12H2,1-2H3,(H2,22,25)/b11-10+/t14-,18+/m0/s1 |
| InChIKey | RLAYFFLOLVZFBU-LVDURTMUSA-N |
| XLogP | 3.10 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.42 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|