C20H19ClN2O2 — CID 51935791
(2S,4S)-1-[(E)-3-(3-chlorophenyl)prop-2-enoyl]-2-methyl-3,4-dihydro-2H-quinoline-4-carboxamide (PubChem CID 51935791) has the molecular formula C20H19ClN2O2 and a molecular weight of 354.84 g/mol. Its IUPAC name is (2S,4S)-1-[(E)-3-(3-chlorophenyl)prop-2-enoyl]-2-methyl-3,4-dihydro-2H-quinoline-4-carboxamide.
| Compound Name | (2S,4S)-1-[(E)-3-(3-chlorophenyl)prop-2-enoyl]-2-methyl-3,4-dihydro-2H-quinoline-4-carboxamide |
|---|---|
| PubChem CID | 51935791 |
| Molecular Formula | C20H19ClN2O2 |
| Molecular Weight | 354.84 g/mol |
| Exact Mass | 354.11 |
| IUPAC Name | (2S,4S)-1-[(E)-3-(3-chlorophenyl)prop-2-enoyl]-2-methyl-3,4-dihydro-2H-quinoline-4-carboxamide |
| SMILES | C[C@H]1C[C@H](C(N)=O)c2ccccc2N1C(=O)/C=C/c1cccc(Cl)c1 |
| InChI | InChI=1S/C20H19ClN2O2/c1-13-11-17(20(22)25)16-7-2-3-8-18(16)23(13)19(24)10-9-14-5-4-6-15(21)12-14/h2-10,12-13,17H,11H2,1H3,(H2,22,25)/b10-9+/t13-,17-/m0/s1 |
| InChIKey | AQSMSCQPVQUJCK-NJJNPSGXSA-N |
| XLogP | 3.75 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.84 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|