C18H15Cl2FN2O2 — CID 51935821
(2S,4R)-1-(2,4-dichloro-5-fluorobenzoyl)-2-methyl-3,4-dihydro-2H-quinoline-4-carboxamide (PubChem CID 51935821) has the molecular formula C18H15Cl2FN2O2 and a molecular weight of 381.23 g/mol. Its IUPAC name is (2S,4R)-1-(2,4-dichloro-5-fluorobenzoyl)-2-methyl-3,4-dihydro-2H-quinoline-4-carboxamide.
| Compound Name | (2S,4R)-1-(2,4-dichloro-5-fluorobenzoyl)-2-methyl-3,4-dihydro-2H-quinoline-4-carboxamide |
|---|---|
| PubChem CID | 51935821 |
| Molecular Formula | C18H15Cl2FN2O2 |
| Molecular Weight | 381.23 g/mol |
| Exact Mass | 380.05 |
| IUPAC Name | (2S,4R)-1-(2,4-dichloro-5-fluorobenzoyl)-2-methyl-3,4-dihydro-2H-quinoline-4-carboxamide |
| SMILES | C[C@H]1C[C@@H](C(N)=O)c2ccccc2N1C(=O)c1cc(F)c(Cl)cc1Cl |
| InChI | InChI=1S/C18H15Cl2FN2O2/c1-9-6-11(17(22)24)10-4-2-3-5-16(10)23(9)18(25)12-7-15(21)14(20)8-13(12)19/h2-5,7-9,11H,6H2,1H3,(H2,22,24)/t9-,11+/m0/s1 |
| InChIKey | FKXWVXPYWNPQME-GXSJLCMTSA-N |
| XLogP | 4.14 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.23 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|