C19H22FN3O — CID 51939239
[(4aS,8aS)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-[3-(4-fluorophenyl)-1H-pyrazol-5-yl]methanone (PubChem CID 51939239) has the molecular formula C19H22FN3O and a molecular weight of 327.40 g/mol. Its IUPAC name is [(4aS,8aS)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-[3-(4-fluorophenyl)-1H-pyrazol-5-yl]methanone.
| Compound Name | [(4aS,8aS)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-[3-(4-fluorophenyl)-1H-pyrazol-5-yl]methanone |
|---|---|
| PubChem CID | 51939239 |
| Molecular Formula | C19H22FN3O |
| Molecular Weight | 327.40 g/mol |
| Exact Mass | 327.17 |
| IUPAC Name | [(4aS,8aS)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-[3-(4-fluorophenyl)-1H-pyrazol-5-yl]methanone |
| SMILES | O=C(c1cc(-c2ccc(F)cc2)n[nH]1)N1CCC[C@@H]2CCCC[C@@H]21 |
| InChI | InChI=1S/C19H22FN3O/c20-15-9-7-13(8-10-15)16-12-17(22-21-16)19(24)23-11-3-5-14-4-1-2-6-18(14)23/h7-10,12,14,18H,1-6,11H2,(H,21,22)/t14-,18-/m0/s1 |
| InChIKey | ADZLSLJKLLVYKX-KSSFIOAISA-N |
| XLogP | 4.01 |
| TPSA | 48.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.40 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |