C22H21F2N3O — CID 70733375
[2-(3-fluorophenyl)azepan-1-yl]-[3-(4-fluorophenyl)-1H-pyrazol-5-yl]methanone (PubChem CID 70733375) has the molecular formula C22H21F2N3O and a molecular weight of 381.43 g/mol. Its IUPAC name is [2-(3-fluorophenyl)azepan-1-yl]-[3-(4-fluorophenyl)-1H-pyrazol-5-yl]methanone.
| Compound Name | [2-(3-fluorophenyl)azepan-1-yl]-[3-(4-fluorophenyl)-1H-pyrazol-5-yl]methanone |
|---|---|
| PubChem CID | 70733375 |
| Molecular Formula | C22H21F2N3O |
| Molecular Weight | 381.43 g/mol |
| Exact Mass | 381.17 |
| IUPAC Name | [2-(3-fluorophenyl)azepan-1-yl]-[3-(4-fluorophenyl)-1H-pyrazol-5-yl]methanone |
| SMILES | O=C(c1cc(-c2ccc(F)cc2)n[nH]1)N1CCCCCC1c1cccc(F)c1 |
| InChI | InChI=1S/C22H21F2N3O/c23-17-10-8-15(9-11-17)19-14-20(26-25-19)22(28)27-12-3-1-2-7-21(27)16-5-4-6-18(24)13-16/h4-6,8-11,13-14,21H,1-3,7,12H2,(H,25,26) |
| InChIKey | XNNCVXHTEALJRH-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 48.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.43 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |