C21H21ClN6O3 — CID 51942763
N-[(2R)-2-(3-chlorophenyl)-2-pyrrolidin-1-ylethyl]-3-nitro-4-(1,2,4-triazol-1-yl)benzamide (PubChem CID 51942763) has the molecular formula C21H21ClN6O3 and a molecular weight of 440.89 g/mol. Its IUPAC name is N-[(2R)-2-(3-chlorophenyl)-2-pyrrolidin-1-ylethyl]-3-nitro-4-(1,2,4-triazol-1-yl)benzamide.
| Compound Name | N-[(2R)-2-(3-chlorophenyl)-2-pyrrolidin-1-ylethyl]-3-nitro-4-(1,2,4-triazol-1-yl)benzamide |
|---|---|
| PubChem CID | 51942763 |
| Molecular Formula | C21H21ClN6O3 |
| Molecular Weight | 440.89 g/mol |
| Exact Mass | 440.14 |
| IUPAC Name | N-[(2R)-2-(3-chlorophenyl)-2-pyrrolidin-1-ylethyl]-3-nitro-4-(1,2,4-triazol-1-yl)benzamide |
| SMILES | O=C(NC[C@@H](c1cccc(Cl)c1)N1CCCC1)c1ccc(-n2cncn2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C21H21ClN6O3/c22-17-5-3-4-15(10-17)20(26-8-1-2-9-26)12-24-21(29)16-6-7-18(19(11-16)28(30)31)27-14-23-13-25-27/h3-7,10-11,13-14,20H,1-2,8-9,12H2,(H,24,29)/t20-/m0/s1 |
| InChIKey | XVCYNJXMPJNDGX-FQEVSTJZSA-N |
| XLogP | 3.40 |
| TPSA | 106.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.89 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|