C22H29ClN4O — CID 51945422
1-[(1R)-1-(4-chlorophenyl)ethyl]-3-[2-(4-ethylpiperazin-1-yl)phenyl]-1-methylurea (PubChem CID 51945422) has the molecular formula C22H29ClN4O and a molecular weight of 400.95 g/mol. Its IUPAC name is 1-[(1R)-1-(4-chlorophenyl)ethyl]-3-[2-(4-ethylpiperazin-1-yl)phenyl]-1-methylurea.
| Compound Name | 1-[(1R)-1-(4-chlorophenyl)ethyl]-3-[2-(4-ethylpiperazin-1-yl)phenyl]-1-methylurea |
|---|---|
| PubChem CID | 51945422 |
| Molecular Formula | C22H29ClN4O |
| Molecular Weight | 400.95 g/mol |
| Exact Mass | 400.20 |
| IUPAC Name | 1-[(1R)-1-(4-chlorophenyl)ethyl]-3-[2-(4-ethylpiperazin-1-yl)phenyl]-1-methylurea |
| SMILES | CCN1CCN(c2ccccc2NC(=O)N(C)[C@H](C)c2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C22H29ClN4O/c1-4-26-13-15-27(16-14-26)21-8-6-5-7-20(21)24-22(28)25(3)17(2)18-9-11-19(23)12-10-18/h5-12,17H,4,13-16H2,1-3H3,(H,24,28)/t17-/m1/s1 |
| InChIKey | UFTODRSXDMBDJJ-QGZVFWFLSA-N |
| XLogP | 4.71 |
| TPSA | 38.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.95 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |