C20H22FN5O2 — CID 51949549
(3S)-5-N-[4-(dimethylamino)-2-methylphenyl]-2-(4-fluorophenyl)-3,4-dihydropyrazole-3,5-dicarboxamide (PubChem CID 51949549) has the molecular formula C20H22FN5O2 and a molecular weight of 383.43 g/mol. Its IUPAC name is (3S)-5-N-[4-(dimethylamino)-2-methylphenyl]-2-(4-fluorophenyl)-3,4-dihydropyrazole-3,5-dicarboxamide.
| Compound Name | (3S)-5-N-[4-(dimethylamino)-2-methylphenyl]-2-(4-fluorophenyl)-3,4-dihydropyrazole-3,5-dicarboxamide |
|---|---|
| PubChem CID | 51949549 |
| Molecular Formula | C20H22FN5O2 |
| Molecular Weight | 383.43 g/mol |
| Exact Mass | 383.18 |
| IUPAC Name | (3S)-5-N-[4-(dimethylamino)-2-methylphenyl]-2-(4-fluorophenyl)-3,4-dihydropyrazole-3,5-dicarboxamide |
| SMILES | Cc1cc(N(C)C)ccc1NC(=O)C1=NN(c2ccc(F)cc2)[C@H](C(N)=O)C1 |
| InChI | InChI=1S/C20H22FN5O2/c1-12-10-15(25(2)3)8-9-16(12)23-20(28)17-11-18(19(22)27)26(24-17)14-6-4-13(21)5-7-14/h4-10,18H,11H2,1-3H3,(H2,22,27)(H,23,28)/t18-/m0/s1 |
| InChIKey | XEONAOYSMNKMIU-SFHVURJKSA-N |
| XLogP | 2.26 |
| TPSA | 91.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.43 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|