C17H13F2N5O4 — CID 60528448
5-N-(2-fluoro-5-nitrophenyl)-2-(4-fluorophenyl)-3,4-dihydropyrazole-3,5-dicarboxamide (PubChem CID 60528448) has the molecular formula C17H13F2N5O4 and a molecular weight of 389.32 g/mol. Its IUPAC name is 5-N-(2-fluoro-5-nitrophenyl)-2-(4-fluorophenyl)-3,4-dihydropyrazole-3,5-dicarboxamide.
| Compound Name | 5-N-(2-fluoro-5-nitrophenyl)-2-(4-fluorophenyl)-3,4-dihydropyrazole-3,5-dicarboxamide |
|---|---|
| PubChem CID | 60528448 |
| Molecular Formula | C17H13F2N5O4 |
| Molecular Weight | 389.32 g/mol |
| Exact Mass | 389.09 |
| IUPAC Name | 5-N-(2-fluoro-5-nitrophenyl)-2-(4-fluorophenyl)-3,4-dihydropyrazole-3,5-dicarboxamide |
| SMILES | NC(=O)C1CC(C(=O)Nc2cc([N+](=O)[O-])ccc2F)=NN1c1ccc(F)cc1 |
| InChI | InChI=1S/C17H13F2N5O4/c18-9-1-3-10(4-2-9)23-15(16(20)25)8-14(22-23)17(26)21-13-7-11(24(27)28)5-6-12(13)19/h1-7,15H,8H2,(H2,20,25)(H,21,26) |
| InChIKey | BRJNDTXRYCTVPI-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 130.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.32 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|