C16H11F2N5O3 — CID 55433917
N-(2-fluoro-5-nitrophenyl)-1-(4-fluorophenyl)-5-methyl-1,2,4-triazole-3-carboxamide (PubChem CID 55433917) has the molecular formula C16H11F2N5O3 and a molecular weight of 359.29 g/mol. Its IUPAC name is N-(2-fluoro-5-nitrophenyl)-1-(4-fluorophenyl)-5-methyl-1,2,4-triazole-3-carboxamide.
| Compound Name | N-(2-fluoro-5-nitrophenyl)-1-(4-fluorophenyl)-5-methyl-1,2,4-triazole-3-carboxamide |
|---|---|
| PubChem CID | 55433917 |
| Molecular Formula | C16H11F2N5O3 |
| Molecular Weight | 359.29 g/mol |
| Exact Mass | 359.08 |
| IUPAC Name | N-(2-fluoro-5-nitrophenyl)-1-(4-fluorophenyl)-5-methyl-1,2,4-triazole-3-carboxamide |
| SMILES | Cc1nc(C(=O)Nc2cc([N+](=O)[O-])ccc2F)nn1-c1ccc(F)cc1 |
| InChI | InChI=1S/C16H11F2N5O3/c1-9-19-15(21-22(9)11-4-2-10(17)3-5-11)16(24)20-14-8-12(23(25)26)6-7-13(14)18/h2-8H,1H3,(H,20,24) |
| InChIKey | SIUBCBPUCCEMLK-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 102.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.29 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|