C10H7FN3O2- — CID 7018908
1-(4-fluorophenyl)-5-methyl-1,2,4-triazole-3-carboxylate (PubChem CID 7018908) has the molecular formula C10H7FN3O2- and a molecular weight of 220.18 g/mol. Its IUPAC name is 1-(4-fluorophenyl)-5-methyl-1,2,4-triazole-3-carboxylate.
| Compound Name | 1-(4-fluorophenyl)-5-methyl-1,2,4-triazole-3-carboxylate |
|---|---|
| PubChem CID | 7018908 |
| Molecular Formula | C10H7FN3O2- |
| Molecular Weight | 220.18 g/mol |
| Exact Mass | 220.05 |
| IUPAC Name | 1-(4-fluorophenyl)-5-methyl-1,2,4-triazole-3-carboxylate |
| SMILES | Cc1nc(C(=O)[O-])nn1-c1ccc(F)cc1 |
| InChI | InChI=1S/C10H8FN3O2/c1-6-12-9(10(15)16)13-14(6)8-4-2-7(11)3-5-8/h2-5H,1H3,(H,15,16)/p-1 |
| InChIKey | IOKWGFCAXYAKKM-UHFFFAOYSA-M |
| XLogP | 0.08 |
| TPSA | 70.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.18 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |