C17H14FN5O2 — CID 46651849
N'-benzoyl-1-(4-fluorophenyl)-5-methyl-1,2,4-triazole-3-carbohydrazide (PubChem CID 46651849) has the molecular formula C17H14FN5O2 and a molecular weight of 339.33 g/mol. Its IUPAC name is N'-benzoyl-1-(4-fluorophenyl)-5-methyl-1,2,4-triazole-3-carbohydrazide.
| Compound Name | N'-benzoyl-1-(4-fluorophenyl)-5-methyl-1,2,4-triazole-3-carbohydrazide |
|---|---|
| PubChem CID | 46651849 |
| Molecular Formula | C17H14FN5O2 |
| Molecular Weight | 339.33 g/mol |
| Exact Mass | 339.11 |
| IUPAC Name | N'-benzoyl-1-(4-fluorophenyl)-5-methyl-1,2,4-triazole-3-carbohydrazide |
| SMILES | Cc1nc(C(=O)NNC(=O)c2ccccc2)nn1-c1ccc(F)cc1 |
| InChI | InChI=1S/C17H14FN5O2/c1-11-19-15(22-23(11)14-9-7-13(18)8-10-14)17(25)21-20-16(24)12-5-3-2-4-6-12/h2-10H,1H3,(H,20,24)(H,21,25) |
| InChIKey | FIYOQPUVQCBUJK-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 88.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.33 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|