C12H11Cl2FN4O — CID 126826968
N-(2,2-dichloroethyl)-1-(4-fluorophenyl)-5-methyl-1,2,4-triazole-3-carboxamide (PubChem CID 126826968) has the molecular formula C12H11Cl2FN4O and a molecular weight of 317.15 g/mol. Its IUPAC name is N-(2,2-dichloroethyl)-1-(4-fluorophenyl)-5-methyl-1,2,4-triazole-3-carboxamide.
| Compound Name | N-(2,2-dichloroethyl)-1-(4-fluorophenyl)-5-methyl-1,2,4-triazole-3-carboxamide |
|---|---|
| PubChem CID | 126826968 |
| Molecular Formula | C12H11Cl2FN4O |
| Molecular Weight | 317.15 g/mol |
| Exact Mass | 316.03 |
| IUPAC Name | N-(2,2-dichloroethyl)-1-(4-fluorophenyl)-5-methyl-1,2,4-triazole-3-carboxamide |
| SMILES | Cc1nc(C(=O)NCC(Cl)Cl)nn1-c1ccc(F)cc1 |
| InChI | InChI=1S/C12H11Cl2FN4O/c1-7-17-11(12(20)16-6-10(13)14)18-19(7)9-4-2-8(15)3-5-9/h2-5,10H,6H2,1H3,(H,16,20) |
| InChIKey | FPHFOGPYFQOVPL-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.15 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|