C15H15FN4O2 — CID 126800803
1-(4-fluorophenyl)-N-(1-hydroxypent-4-yn-2-yl)-5-methyl-1,2,4-triazole-3-carboxamide (PubChem CID 126800803) has the molecular formula C15H15FN4O2 and a molecular weight of 302.31 g/mol. Its IUPAC name is 1-(4-fluorophenyl)-N-(1-hydroxypent-4-yn-2-yl)-5-methyl-1,2,4-triazole-3-carboxamide.
| Compound Name | 1-(4-fluorophenyl)-N-(1-hydroxypent-4-yn-2-yl)-5-methyl-1,2,4-triazole-3-carboxamide |
|---|---|
| PubChem CID | 126800803 |
| Molecular Formula | C15H15FN4O2 |
| Molecular Weight | 302.31 g/mol |
| Exact Mass | 302.12 |
| IUPAC Name | 1-(4-fluorophenyl)-N-(1-hydroxypent-4-yn-2-yl)-5-methyl-1,2,4-triazole-3-carboxamide |
| SMILES | C#CCC(CO)NC(=O)c1nc(C)n(-c2ccc(F)cc2)n1 |
| InChI | InChI=1S/C15H15FN4O2/c1-3-4-12(9-21)18-15(22)14-17-10(2)20(19-14)13-7-5-11(16)6-8-13/h1,5-8,12,21H,4,9H2,2H3,(H,18,22) |
| InChIKey | CFWAMTOTVFYNFK-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 80.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.31 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|