C14H15FN4O3S — CID 119241397
2-[2-[[1-(4-fluorophenyl)-5-methyl-1,2,4-triazole-3-carbonyl]amino]ethylsulfanyl]acetic acid (PubChem CID 119241397) has the molecular formula C14H15FN4O3S and a molecular weight of 338.36 g/mol. Its IUPAC name is 2-[2-[[1-(4-fluorophenyl)-5-methyl-1,2,4-triazole-3-carbonyl]amino]ethylsulfanyl]acetic acid.
| Compound Name | 2-[2-[[1-(4-fluorophenyl)-5-methyl-1,2,4-triazole-3-carbonyl]amino]ethylsulfanyl]acetic acid |
|---|---|
| PubChem CID | 119241397 |
| Molecular Formula | C14H15FN4O3S |
| Molecular Weight | 338.36 g/mol |
| Exact Mass | 338.08 |
| IUPAC Name | 2-[2-[[1-(4-fluorophenyl)-5-methyl-1,2,4-triazole-3-carbonyl]amino]ethylsulfanyl]acetic acid |
| SMILES | Cc1nc(C(=O)NCCSCC(=O)O)nn1-c1ccc(F)cc1 |
| InChI | InChI=1S/C14H15FN4O3S/c1-9-17-13(14(22)16-6-7-23-8-12(20)21)18-19(9)11-4-2-10(15)3-5-11/h2-5H,6-8H2,1H3,(H,16,22)(H,20,21) |
| InChIKey | CSTRGYNETHNHCB-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 97.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.36 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|