C20H28FN5O — CID 55735231
N-[3-(3,5-dimethylpiperidin-1-yl)propyl]-1-(4-fluorophenyl)-5-methyl-1,2,4-triazole-3-carboxamide (PubChem CID 55735231) has the molecular formula C20H28FN5O and a molecular weight of 373.48 g/mol. Its IUPAC name is N-[3-(3,5-dimethylpiperidin-1-yl)propyl]-1-(4-fluorophenyl)-5-methyl-1,2,4-triazole-3-carboxamide.
| Compound Name | N-[3-(3,5-dimethylpiperidin-1-yl)propyl]-1-(4-fluorophenyl)-5-methyl-1,2,4-triazole-3-carboxamide |
|---|---|
| PubChem CID | 55735231 |
| Molecular Formula | C20H28FN5O |
| Molecular Weight | 373.48 g/mol |
| Exact Mass | 373.23 |
| IUPAC Name | N-[3-(3,5-dimethylpiperidin-1-yl)propyl]-1-(4-fluorophenyl)-5-methyl-1,2,4-triazole-3-carboxamide |
| SMILES | Cc1nc(C(=O)NCCCN2CC(C)CC(C)C2)nn1-c1ccc(F)cc1 |
| InChI | InChI=1S/C20H28FN5O/c1-14-11-15(2)13-25(12-14)10-4-9-22-20(27)19-23-16(3)26(24-19)18-7-5-17(21)6-8-18/h5-8,14-15H,4,9-13H2,1-3H3,(H,22,27) |
| InChIKey | GTESHTMQGOXGRP-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 63.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.48 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|