C15H17N3O6S — CID 51951241
5-[[(4S)-4-(furan-2-yl)-4-methyl-2,5-dioxoimidazolidin-1-yl]methyl]-N,N-dimethylfuran-2-sulfonamide (PubChem CID 51951241) has the molecular formula C15H17N3O6S and a molecular weight of 367.38 g/mol. Its IUPAC name is 5-[[(4S)-4-(furan-2-yl)-4-methyl-2,5-dioxoimidazolidin-1-yl]methyl]-N,N-dimethylfuran-2-sulfonamide.
| Compound Name | 5-[[(4S)-4-(furan-2-yl)-4-methyl-2,5-dioxoimidazolidin-1-yl]methyl]-N,N-dimethylfuran-2-sulfonamide |
|---|---|
| PubChem CID | 51951241 |
| Molecular Formula | C15H17N3O6S |
| Molecular Weight | 367.38 g/mol |
| Exact Mass | 367.08 |
| IUPAC Name | 5-[[(4S)-4-(furan-2-yl)-4-methyl-2,5-dioxoimidazolidin-1-yl]methyl]-N,N-dimethylfuran-2-sulfonamide |
| SMILES | CN(C)S(=O)(=O)c1ccc(CN2C(=O)N[C@@](C)(c3ccco3)C2=O)o1 |
| InChI | InChI=1S/C15H17N3O6S/c1-15(11-5-4-8-23-11)13(19)18(14(20)16-15)9-10-6-7-12(24-10)25(21,22)17(2)3/h4-8H,9H2,1-3H3,(H,16,20)/t15-/m0/s1 |
| InChIKey | MIOACQPPCVOTAT-HNNXBMFYSA-N |
| XLogP | 1.09 |
| TPSA | 113.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.38 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|