C25H34N2O8 — CID 5195222
3-O,5-O-diethyl 4-O-[2-[1-(2-methoxyethyl)-2,5-dimethylpyrrol-3-yl]-2-oxoethyl] 2,6-dimethyl-1,4-dihydropyridine-3,4,5-tricarboxylate (PubChem CID 5195222) has the molecular formula C25H34N2O8 and a molecular weight of 490.55 g/mol. Its IUPAC name is 3-O,5-O-diethyl 4-O-[2-[1-(2-methoxyethyl)-2,5-dimethylpyrrol-3-yl]-2-oxoethyl] 2,6-dimethyl-1,4-dihydropyridine-3,4,5-tricarboxylate.
| Compound Name | 3-O,5-O-diethyl 4-O-[2-[1-(2-methoxyethyl)-2,5-dimethylpyrrol-3-yl]-2-oxoethyl] 2,6-dimethyl-1,4-dihydropyridine-3,4,5-tricarboxylate |
|---|---|
| PubChem CID | 5195222 |
| Molecular Formula | C25H34N2O8 |
| Molecular Weight | 490.55 g/mol |
| Exact Mass | 490.23 |
| IUPAC Name | 3-O,5-O-diethyl 4-O-[2-[1-(2-methoxyethyl)-2,5-dimethylpyrrol-3-yl]-2-oxoethyl] 2,6-dimethyl-1,4-dihydropyridine-3,4,5-tricarboxylate |
| SMILES | CCOC(=O)C1=C(C)NC(C)=C(C(=O)OCC)C1C(=O)OCC(=O)c1cc(C)n(CCOC)c1C |
| InChI | InChI=1S/C25H34N2O8/c1-8-33-23(29)20-15(4)26-16(5)21(24(30)34-9-2)22(20)25(31)35-13-19(28)18-12-14(3)27(17(18)6)10-11-32-7/h12,22,26H,8-11,13H2,1-7H3 |
| InChIKey | XFEXRSYZTNMUHM-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 122.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.55 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|