C20H19Cl2N3O2 — CID 51960641
(3R)-1-[(E)-3-(2,5-dichlorophenyl)prop-2-enoyl]-N-pyridin-2-ylpiperidine-3-carboxamide (PubChem CID 51960641) has the molecular formula C20H19Cl2N3O2 and a molecular weight of 404.30 g/mol. Its IUPAC name is (3R)-1-[(E)-3-(2,5-dichlorophenyl)prop-2-enoyl]-N-pyridin-2-ylpiperidine-3-carboxamide.
| Compound Name | (3R)-1-[(E)-3-(2,5-dichlorophenyl)prop-2-enoyl]-N-pyridin-2-ylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 51960641 |
| Molecular Formula | C20H19Cl2N3O2 |
| Molecular Weight | 404.30 g/mol |
| Exact Mass | 403.09 |
| IUPAC Name | (3R)-1-[(E)-3-(2,5-dichlorophenyl)prop-2-enoyl]-N-pyridin-2-ylpiperidine-3-carboxamide |
| SMILES | O=C(Nc1ccccn1)[C@@H]1CCCN(C(=O)/C=C/c2cc(Cl)ccc2Cl)C1 |
| InChI | InChI=1S/C20H19Cl2N3O2/c21-16-7-8-17(22)14(12-16)6-9-19(26)25-11-3-4-15(13-25)20(27)24-18-5-1-2-10-23-18/h1-2,5-10,12,15H,3-4,11,13H2,(H,23,24,27)/b9-6+/t15-/m1/s1 |
| InChIKey | NWCRBCUNFSRHIA-RZIFZGNASA-N |
| XLogP | 4.28 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.30 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|