C16H20N2S2 — CID 51965493
3-[[cyclopropyl-[(1S)-2,3-dihydro-1H-inden-1-yl]amino]methyl]-1,3-thiazolidine-2-thione (PubChem CID 51965493) has the molecular formula C16H20N2S2 and a molecular weight of 304.48 g/mol. Its IUPAC name is 3-[[cyclopropyl-[(1S)-2,3-dihydro-1H-inden-1-yl]amino]methyl]-1,3-thiazolidine-2-thione.
| Compound Name | 3-[[cyclopropyl-[(1S)-2,3-dihydro-1H-inden-1-yl]amino]methyl]-1,3-thiazolidine-2-thione |
|---|---|
| PubChem CID | 51965493 |
| Molecular Formula | C16H20N2S2 |
| Molecular Weight | 304.48 g/mol |
| Exact Mass | 304.11 |
| IUPAC Name | 3-[[cyclopropyl-[(1S)-2,3-dihydro-1H-inden-1-yl]amino]methyl]-1,3-thiazolidine-2-thione |
| SMILES | S=C1SCCN1CN(C1CC1)[C@H]1CCc2ccccc21 |
| InChI | InChI=1S/C16H20N2S2/c19-16-17(9-10-20-16)11-18(13-6-7-13)15-8-5-12-3-1-2-4-14(12)15/h1-4,13,15H,5-11H2/t15-/m0/s1 |
| InChIKey | LQPWLVMQVLKSRL-HNNXBMFYSA-N |
| XLogP | 3.43 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.48 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|