C21H21N5O3 — CID 51976266
4-(methoxymethyl)-11-[[(2S)-oxolan-2-yl]methyl]-5-phenyl-2,3,7,8,11-pentazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,12-pentaen-10-one (PubChem CID 51976266) has the molecular formula C21H21N5O3 and a molecular weight of 391.43 g/mol. Its IUPAC name is 4-(methoxymethyl)-11-[[(2S)-oxolan-2-yl]methyl]-5-phenyl-2,3,7,8,11-pentazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,12-pentaen-10-one.
| Compound Name | 4-(methoxymethyl)-11-[[(2S)-oxolan-2-yl]methyl]-5-phenyl-2,3,7,8,11-pentazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,12-pentaen-10-one |
|---|---|
| PubChem CID | 51976266 |
| Molecular Formula | C21H21N5O3 |
| Molecular Weight | 391.43 g/mol |
| Exact Mass | 391.16 |
| IUPAC Name | 4-(methoxymethyl)-11-[[(2S)-oxolan-2-yl]methyl]-5-phenyl-2,3,7,8,11-pentazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,12-pentaen-10-one |
| SMILES | COCc1nn2c(nnc3c(=O)n(C[C@@H]4CCCO4)ccc32)c1-c1ccccc1 |
| InChI | InChI=1S/C21H21N5O3/c1-28-13-16-18(14-6-3-2-4-7-14)20-23-22-19-17(26(20)24-16)9-10-25(21(19)27)12-15-8-5-11-29-15/h2-4,6-7,9-10,15H,5,8,11-13H2,1H3/t15-/m0/s1 |
| InChIKey | ZLIWCQCOUIQEOT-HNNXBMFYSA-N |
| XLogP | 2.43 |
| TPSA | 83.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.43 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |