C22H28CuN4S4 — CID 5197643
copper;bis([methylsulfanyl(sulfoniumylidene)methyl]-(1-phenylpropylideneamino)azanide) (PubChem CID 5197643) has the molecular formula C22H28CuN4S4 and a molecular weight of 540.31 g/mol. Its IUPAC name is copper;bis([methylsulfanyl(sulfoniumylidene)methyl]-(1-phenylpropylideneamino)azanide).
| Compound Name | copper;bis([methylsulfanyl(sulfoniumylidene)methyl]-(1-phenylpropylideneamino)azanide) |
|---|---|
| PubChem CID | 5197643 |
| Molecular Formula | C22H28CuN4S4 |
| Molecular Weight | 540.31 g/mol |
| Exact Mass | 539.05 |
| IUPAC Name | copper;bis([methylsulfanyl(sulfoniumylidene)methyl]-(1-phenylpropylideneamino)azanide) |
| SMILES | [Cu].[H]/[S+]=C(/[N-]N=C(CC)c1ccccc1)SC.[H]/[S+]=C(/[N-]N=C(CC)c1ccccc1)SC |
| InChI | InChI=1S/2C11H14N2S2.Cu/c2*1-3-10(12-13-11(14)15-2)9-7-5-4-6-8-9;/h2*4-8H,3H2,1-2H3,(H,13,14); |
| InChIKey | GICNDPPTKJOQKO-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 52.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.31 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|