C17H18N2O2S2 — CID 51983080
N-[(1S)-1-(1-benzofuran-2-yl)ethyl]-N-methyl-2-(4-methyl-2-sulfanylidene-3H-1,3-thiazol-5-yl)acetamide (PubChem CID 51983080) has the molecular formula C17H18N2O2S2 and a molecular weight of 346.48 g/mol. Its IUPAC name is N-[(1S)-1-(1-benzofuran-2-yl)ethyl]-N-methyl-2-(4-methyl-2-sulfanylidene-3H-1,3-thiazol-5-yl)acetamide.
| Compound Name | N-[(1S)-1-(1-benzofuran-2-yl)ethyl]-N-methyl-2-(4-methyl-2-sulfanylidene-3H-1,3-thiazol-5-yl)acetamide |
|---|---|
| PubChem CID | 51983080 |
| Molecular Formula | C17H18N2O2S2 |
| Molecular Weight | 346.48 g/mol |
| Exact Mass | 346.08 |
| IUPAC Name | N-[(1S)-1-(1-benzofuran-2-yl)ethyl]-N-methyl-2-(4-methyl-2-sulfanylidene-3H-1,3-thiazol-5-yl)acetamide |
| SMILES | Cc1[nH]c(=S)sc1CC(=O)N(C)[C@@H](C)c1cc2ccccc2o1 |
| InChI | InChI=1S/C17H18N2O2S2/c1-10-15(23-17(22)18-10)9-16(20)19(3)11(2)14-8-12-6-4-5-7-13(12)21-14/h4-8,11H,9H2,1-3H3,(H,18,22)/t11-/m0/s1 |
| InChIKey | ZARXSSPLAPPTHE-NSHDSACASA-N |
| XLogP | 4.62 |
| TPSA | 49.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.48 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|