C16H16Cl2NO4+ — CID 5198708
(1-methylpiperidin-1-ium-4-yl) 6,8-dichloro-2-oxochromene-3-carboxylate (PubChem CID 5198708) has the molecular formula C16H16Cl2NO4+ and a molecular weight of 357.21 g/mol. Its IUPAC name is (1-methylpiperidin-1-ium-4-yl) 6,8-dichloro-2-oxochromene-3-carboxylate.
| Compound Name | (1-methylpiperidin-1-ium-4-yl) 6,8-dichloro-2-oxochromene-3-carboxylate |
|---|---|
| PubChem CID | 5198708 |
| Molecular Formula | C16H16Cl2NO4+ |
| Molecular Weight | 357.21 g/mol |
| Exact Mass | 356.05 |
| IUPAC Name | (1-methylpiperidin-1-ium-4-yl) 6,8-dichloro-2-oxochromene-3-carboxylate |
| SMILES | C[NH+]1CCC(OC(=O)c2cc3cc(Cl)cc(Cl)c3oc2=O)CC1 |
| InChI | InChI=1S/C16H15Cl2NO4/c1-19-4-2-11(3-5-19)22-15(20)12-7-9-6-10(17)8-13(18)14(9)23-16(12)21/h6-8,11H,2-5H2,1H3/p+1 |
| InChIKey | ZVFFQIXZHATXBE-UHFFFAOYSA-O |
| XLogP | 1.93 |
| TPSA | 60.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.21 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|