C22H19ClN2O3 — CID 51987962
(2R)-2-[[5-(2-chlorophenyl)furan-2-yl]methylamino]-3-(1H-indol-3-yl)propanoic acid (PubChem CID 51987962) has the molecular formula C22H19ClN2O3 and a molecular weight of 394.86 g/mol. Its IUPAC name is (2R)-2-[[5-(2-chlorophenyl)furan-2-yl]methylamino]-3-(1H-indol-3-yl)propanoic acid.
| Compound Name | (2R)-2-[[5-(2-chlorophenyl)furan-2-yl]methylamino]-3-(1H-indol-3-yl)propanoic acid |
|---|---|
| PubChem CID | 51987962 |
| Molecular Formula | C22H19ClN2O3 |
| Molecular Weight | 394.86 g/mol |
| Exact Mass | 394.11 |
| IUPAC Name | (2R)-2-[[5-(2-chlorophenyl)furan-2-yl]methylamino]-3-(1H-indol-3-yl)propanoic acid |
| SMILES | O=C(O)[C@@H](Cc1c[nH]c2ccccc12)NCc1ccc(-c2ccccc2Cl)o1 |
| InChI | InChI=1S/C22H19ClN2O3/c23-18-7-3-1-6-17(18)21-10-9-15(28-21)13-25-20(22(26)27)11-14-12-24-19-8-4-2-5-16(14)19/h1-10,12,20,24-25H,11,13H2,(H,26,27)/t20-/m1/s1 |
| InChIKey | GVPOMJKIKPSZIP-HXUWFJFHSA-N |
| XLogP | 4.87 |
| TPSA | 78.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.86 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |