C21H25N3O — CID 5199563
4-phenyl-N-[(1-propan-2-ylpiperidin-4-ylidene)amino]benzamide (PubChem CID 5199563) has the molecular formula C21H25N3O and a molecular weight of 335.45 g/mol. Its IUPAC name is 4-phenyl-N-[(1-propan-2-ylpiperidin-4-ylidene)amino]benzamide.
| Compound Name | 4-phenyl-N-[(1-propan-2-ylpiperidin-4-ylidene)amino]benzamide |
|---|---|
| PubChem CID | 5199563 |
| Molecular Formula | C21H25N3O |
| Molecular Weight | 335.45 g/mol |
| Exact Mass | 335.20 |
| IUPAC Name | 4-phenyl-N-[(1-propan-2-ylpiperidin-4-ylidene)amino]benzamide |
| SMILES | CC(C)N1CCC(=NNC(=O)c2ccc(-c3ccccc3)cc2)CC1 |
| InChI | InChI=1S/C21H25N3O/c1-16(2)24-14-12-20(13-15-24)22-23-21(25)19-10-8-18(9-11-19)17-6-4-3-5-7-17/h3-11,16H,12-15H2,1-2H3,(H,23,25) |
| InChIKey | YFZCRXSLUYAXOH-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 44.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.45 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|