C18H21Cl2NO2 — CID 51996369
(2R)-2-[[5-chloro-2-[(3-chlorophenyl)methoxy]phenyl]methylamino]butan-1-ol (PubChem CID 51996369) has the molecular formula C18H21Cl2NO2 and a molecular weight of 354.28 g/mol. Its IUPAC name is (2R)-2-[[5-chloro-2-[(3-chlorophenyl)methoxy]phenyl]methylamino]butan-1-ol.
| Compound Name | (2R)-2-[[5-chloro-2-[(3-chlorophenyl)methoxy]phenyl]methylamino]butan-1-ol |
|---|---|
| PubChem CID | 51996369 |
| Molecular Formula | C18H21Cl2NO2 |
| Molecular Weight | 354.28 g/mol |
| Exact Mass | 353.09 |
| IUPAC Name | (2R)-2-[[5-chloro-2-[(3-chlorophenyl)methoxy]phenyl]methylamino]butan-1-ol |
| SMILES | CC[C@H](CO)NCc1cc(Cl)ccc1OCc1cccc(Cl)c1 |
| InChI | InChI=1S/C18H21Cl2NO2/c1-2-17(11-22)21-10-14-9-16(20)6-7-18(14)23-12-13-4-3-5-15(19)8-13/h3-9,17,21-22H,2,10-12H2,1H3/t17-/m1/s1 |
| InChIKey | JEYXXJHYMUHTRD-QGZVFWFLSA-N |
| XLogP | 4.43 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.28 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |