C20H22N6O2 — CID 51998736
5-(cyclopropanecarbonylamino)-1-phenyl-N-(3-pyrazol-1-ylpropyl)pyrazole-3-carboxamide (PubChem CID 51998736) has the molecular formula C20H22N6O2 and a molecular weight of 378.44 g/mol. Its IUPAC name is 5-(cyclopropanecarbonylamino)-1-phenyl-N-(3-pyrazol-1-ylpropyl)pyrazole-3-carboxamide.
| Compound Name | 5-(cyclopropanecarbonylamino)-1-phenyl-N-(3-pyrazol-1-ylpropyl)pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 51998736 |
| Molecular Formula | C20H22N6O2 |
| Molecular Weight | 378.44 g/mol |
| Exact Mass | 378.18 |
| IUPAC Name | 5-(cyclopropanecarbonylamino)-1-phenyl-N-(3-pyrazol-1-ylpropyl)pyrazole-3-carboxamide |
| SMILES | O=C(NCCCn1cccn1)c1cc(NC(=O)C2CC2)n(-c2ccccc2)n1 |
| InChI | InChI=1S/C20H22N6O2/c27-19(15-8-9-15)23-18-14-17(24-26(18)16-6-2-1-3-7-16)20(28)21-10-4-12-25-13-5-11-22-25/h1-3,5-7,11,13-15H,4,8-10,12H2,(H,21,28)(H,23,27) |
| InChIKey | MIWVDIMUEXEWLW-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 93.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.44 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|