C22H23N5O — CID 37392411
(3R)-2,3-diphenyl-N-(3-pyrazol-1-ylpropyl)-3,4-dihydropyrazole-5-carboxamide (PubChem CID 37392411) has the molecular formula C22H23N5O and a molecular weight of 373.46 g/mol. Its IUPAC name is (3R)-2,3-diphenyl-N-(3-pyrazol-1-ylpropyl)-3,4-dihydropyrazole-5-carboxamide.
| Compound Name | (3R)-2,3-diphenyl-N-(3-pyrazol-1-ylpropyl)-3,4-dihydropyrazole-5-carboxamide |
|---|---|
| PubChem CID | 37392411 |
| Molecular Formula | C22H23N5O |
| Molecular Weight | 373.46 g/mol |
| Exact Mass | 373.19 |
| IUPAC Name | (3R)-2,3-diphenyl-N-(3-pyrazol-1-ylpropyl)-3,4-dihydropyrazole-5-carboxamide |
| SMILES | O=C(NCCCn1cccn1)C1=NN(c2ccccc2)[C@@H](c2ccccc2)C1 |
| InChI | InChI=1S/C22H23N5O/c28-22(23-13-7-15-26-16-8-14-24-26)20-17-21(18-9-3-1-4-10-18)27(25-20)19-11-5-2-6-12-19/h1-6,8-12,14,16,21H,7,13,15,17H2,(H,23,28)/t21-/m1/s1 |
| InChIKey | SDERHMOQDHBVPT-OAQYLSRUSA-N |
| XLogP | 3.40 |
| TPSA | 62.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.46 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|