C23H25N5O2 — CID 51999445
5-acetamido-1-phenyl-N-(4-piperidin-1-ylphenyl)pyrazole-3-carboxamide (PubChem CID 51999445) has the molecular formula C23H25N5O2 and a molecular weight of 403.49 g/mol. Its IUPAC name is 5-acetamido-1-phenyl-N-(4-piperidin-1-ylphenyl)pyrazole-3-carboxamide.
| Compound Name | 5-acetamido-1-phenyl-N-(4-piperidin-1-ylphenyl)pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 51999445 |
| Molecular Formula | C23H25N5O2 |
| Molecular Weight | 403.49 g/mol |
| Exact Mass | 403.20 |
| IUPAC Name | 5-acetamido-1-phenyl-N-(4-piperidin-1-ylphenyl)pyrazole-3-carboxamide |
| SMILES | CC(=O)Nc1cc(C(=O)Nc2ccc(N3CCCCC3)cc2)nn1-c1ccccc1 |
| InChI | InChI=1S/C23H25N5O2/c1-17(29)24-22-16-21(26-28(22)20-8-4-2-5-9-20)23(30)25-18-10-12-19(13-11-18)27-14-6-3-7-15-27/h2,4-5,8-13,16H,3,6-7,14-15H2,1H3,(H,24,29)(H,25,30) |
| InChIKey | DWAFLSIWUOGJDG-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 79.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.49 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|