C21H20F2N4O — CID 55892546
N-(3,5-difluoro-4-pyrrolidin-1-ylphenyl)-5-methyl-1-phenylpyrazole-3-carboxamide (PubChem CID 55892546) has the molecular formula C21H20F2N4O and a molecular weight of 382.41 g/mol. Its IUPAC name is N-(3,5-difluoro-4-pyrrolidin-1-ylphenyl)-5-methyl-1-phenylpyrazole-3-carboxamide.
| Compound Name | N-(3,5-difluoro-4-pyrrolidin-1-ylphenyl)-5-methyl-1-phenylpyrazole-3-carboxamide |
|---|---|
| PubChem CID | 55892546 |
| Molecular Formula | C21H20F2N4O |
| Molecular Weight | 382.41 g/mol |
| Exact Mass | 382.16 |
| IUPAC Name | N-(3,5-difluoro-4-pyrrolidin-1-ylphenyl)-5-methyl-1-phenylpyrazole-3-carboxamide |
| SMILES | Cc1cc(C(=O)Nc2cc(F)c(N3CCCC3)c(F)c2)nn1-c1ccccc1 |
| InChI | InChI=1S/C21H20F2N4O/c1-14-11-19(25-27(14)16-7-3-2-4-8-16)21(28)24-15-12-17(22)20(18(23)13-15)26-9-5-6-10-26/h2-4,7-8,11-13H,5-6,9-10H2,1H3,(H,24,28) |
| InChIKey | AUVVQGZRESUHAC-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.41 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|